C17H13ClN4O5S — CID 43038013
N-[4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-1,3-thiazol-2-yl]-N-ethylacetamide (PubChem CID 43038013) has the molecular formula C17H13ClN4O5S and a molecular weight of 420.83 g/mol. Its IUPAC name is N-[4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-1,3-thiazol-2-yl]-N-ethylacetamide.
| Compound Name | N-[4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-1,3-thiazol-2-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 43038013 |
| Molecular Formula | C17H13ClN4O5S |
| Molecular Weight | 420.83 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | N-[4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-1,3-thiazol-2-yl]-N-ethylacetamide |
| SMILES | CCN(C(C)=O)c1nc(/C=C2\N=C(c3ccc(Cl)c([N+](=O)[O-])c3)OC2=O)cs1 |
| InChI | InChI=1S/C17H13ClN4O5S/c1-3-21(9(2)23)17-19-11(8-28-17)7-13-16(24)27-15(20-13)10-4-5-12(18)14(6-10)22(25)26/h4-8H,3H2,1-2H3/b13-7- |
| InChIKey | YXNYWWHXYDFJBA-QPEQYQDCSA-N |
| XLogP | 3.42 |
| TPSA | 115.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|