C20H13ClI2N2O7 — CID 19662602
ethyl 2-[4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenoxy]acetate (PubChem CID 19662602) has the molecular formula C20H13ClI2N2O7 and a molecular weight of 682.59 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenoxy]acetate |
|---|---|
| PubChem CID | 19662602 |
| Molecular Formula | C20H13ClI2N2O7 |
| Molecular Weight | 682.59 g/mol |
| Exact Mass | 681.85 |
| IUPAC Name | ethyl 2-[4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2\N=C(c3ccc(Cl)c([N+](=O)[O-])c3)OC2=O)cc1I |
| InChI | InChI=1S/C20H13ClI2N2O7/c1-2-30-17(26)9-31-18-13(22)5-10(6-14(18)23)7-15-20(27)32-19(24-15)11-3-4-12(21)16(8-11)25(28)29/h3-8H,2,9H2,1H3/b15-7- |
| InChIKey | FHPMUSMNJGDSJI-CHHVJCJISA-N |
| XLogP | 4.74 |
| TPSA | 117.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|