C18H13ClN2O6 — CID 3284389
2-(4-chloro-3-nitrophenyl)-4-[(4-ethoxy-2-hydroxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 3284389) has the molecular formula C18H13ClN2O6 and a molecular weight of 388.76 g/mol. Its IUPAC name is 2-(4-chloro-3-nitrophenyl)-4-[(4-ethoxy-2-hydroxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(4-chloro-3-nitrophenyl)-4-[(4-ethoxy-2-hydroxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3284389 |
| Molecular Formula | C18H13ClN2O6 |
| Molecular Weight | 388.76 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-(4-chloro-3-nitrophenyl)-4-[(4-ethoxy-2-hydroxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(C=C2N=C(c3ccc(Cl)c([N+](=O)[O-])c3)OC2=O)c(O)c1 |
| InChI | InChI=1S/C18H13ClN2O6/c1-2-26-12-5-3-10(16(22)9-12)7-14-18(23)27-17(20-14)11-4-6-13(19)15(8-11)21(24)25/h3-9,22H,2H2,1H3 |
| InChIKey | RLDPCICZHNGZND-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.76 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|