C15H19N3O3S — CID 46663317
butyl (E)-3-[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]-2-cyanoprop-2-enoate (PubChem CID 46663317) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is butyl (E)-3-[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]-2-cyanoprop-2-enoate.
| Compound Name | butyl (E)-3-[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 46663317 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | butyl (E)-3-[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]-2-cyanoprop-2-enoate |
| SMILES | CCCCOC(=O)/C(C#N)=C/c1csc(N(CC)C(C)=O)n1 |
| InChI | InChI=1S/C15H19N3O3S/c1-4-6-7-21-14(20)12(9-16)8-13-10-22-15(17-13)18(5-2)11(3)19/h8,10H,4-7H2,1-3H3/b12-8+ |
| InChIKey | KTYUYZIWUURYHI-XYOKQWHBSA-N |
| XLogP | 2.77 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|