C22H17ClN4O2S2 — CID 43025743
N-[4-[(Z)-[1-(4-chloro-2-methylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-1,3-thiazol-2-yl]-N-phenylacetamide (PubChem CID 43025743) has the molecular formula C22H17ClN4O2S2 and a molecular weight of 468.99 g/mol. Its IUPAC name is N-[4-[(Z)-[1-(4-chloro-2-methylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-1,3-thiazol-2-yl]-N-phenylacetamide.
| Compound Name | N-[4-[(Z)-[1-(4-chloro-2-methylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 43025743 |
| Molecular Formula | C22H17ClN4O2S2 |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | N-[4-[(Z)-[1-(4-chloro-2-methylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(/C=C2\NC(=S)N(c3ccc(Cl)cc3C)C2=O)cs1 |
| InChI | InChI=1S/C22H17ClN4O2S2/c1-13-10-15(23)8-9-19(13)27-20(29)18(25-21(27)30)11-16-12-31-22(24-16)26(14(2)28)17-6-4-3-5-7-17/h3-12H,1-2H3,(H,25,30)/b18-11- |
| InChIKey | CRGOZOZVJSXSMI-WQRHYEAKSA-N |
| XLogP | 5.05 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|