C21H14F2N4O2S2 — CID 24510243
N-(2-fluorophenyl)-N-[4-[(Z)-[1-(2-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 24510243) has the molecular formula C21H14F2N4O2S2 and a molecular weight of 456.50 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N-[4-[(Z)-[1-(2-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-N-[4-[(Z)-[1-(2-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 24510243 |
| Molecular Formula | C21H14F2N4O2S2 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | N-(2-fluorophenyl)-N-[4-[(Z)-[1-(2-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)N(c1nc(/C=C2\NC(=S)N(c3ccccc3F)C2=O)cs1)c1ccccc1F |
| InChI | InChI=1S/C21H14F2N4O2S2/c1-12(28)26(17-8-4-2-6-14(17)22)21-24-13(11-31-21)10-16-19(29)27(20(30)25-16)18-9-5-3-7-15(18)23/h2-11H,1H3,(H,25,30)/b16-10- |
| InChIKey | RTSZGOLNIMFNIU-YBEGLDIGSA-N |
| XLogP | 4.37 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|