C18H16FN3O2S3 — CID 167955239
N-(2-fluorophenyl)-N-[4-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 167955239) has the molecular formula C18H16FN3O2S3 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N-[4-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-N-[4-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 167955239 |
| Molecular Formula | C18H16FN3O2S3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | N-(2-fluorophenyl)-N-[4-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CCCN1C(=O)/C(=C\c2csc(N(C(C)=O)c3ccccc3F)n2)SC1=S |
| InChI | InChI=1S/C18H16FN3O2S3/c1-3-8-21-16(24)15(27-18(21)25)9-12-10-26-17(20-12)22(11(2)23)14-7-5-4-6-13(14)19/h4-7,9-10H,3,8H2,1-2H3/b15-9+ |
| InChIKey | KDMLNXTUJONOAT-OQLLNIDSSA-N |
| XLogP | 4.58 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|