C21H24FN3O2S — CID 26877373
(E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(4-methylcyclohexyl)prop-2-enamide (PubChem CID 26877373) has the molecular formula C21H24FN3O2S and a molecular weight of 401.51 g/mol. Its IUPAC name is (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(4-methylcyclohexyl)prop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(4-methylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 26877373 |
| Molecular Formula | C21H24FN3O2S |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(4-methylcyclohexyl)prop-2-enamide |
| SMILES | CC(=O)N(c1nc(/C=C/C(=O)NC2CCC(C)CC2)cs1)c1ccccc1F |
| InChI | InChI=1S/C21H24FN3O2S/c1-14-7-9-16(10-8-14)23-20(27)12-11-17-13-28-21(24-17)25(15(2)26)19-6-4-3-5-18(19)22/h3-6,11-14,16H,7-10H2,1-2H3,(H,23,27)/b12-11+ |
| InChIKey | LJXKWGRMXFMMCD-VAWYXSNFSA-N |
| XLogP | 4.67 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|