C13H13FN6OS — CID 9057964
N-[4-[(Z)-(diaminomethylidenehydrazinylidene)methyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 9057964) has the molecular formula C13H13FN6OS and a molecular weight of 320.35 g/mol. Its IUPAC name is N-[4-[(Z)-(diaminomethylidenehydrazinylidene)methyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | N-[4-[(Z)-(diaminomethylidenehydrazinylidene)methyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 9057964 |
| Molecular Formula | C13H13FN6OS |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-[4-[(Z)-(diaminomethylidenehydrazinylidene)methyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | CC(=O)N(c1nc(/C=N\N=C(N)N)cs1)c1ccccc1F |
| InChI | InChI=1S/C13H13FN6OS/c1-8(21)20(11-5-3-2-4-10(11)14)13-18-9(7-22-13)6-17-19-12(15)16/h2-7H,1H3,(H4,15,16,19)/b17-6- |
| InChIKey | LNXPFWMFSSKFOW-FMQZQXMHSA-N |
| XLogP | 1.57 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|