C20H13FN2OS — CID 98671229
(5Z)-3-(2-fluorophenyl)-5-(naphthalen-2-ylmethylidene)-2-sulfanylideneimidazolidin-4-one (PubChem CID 98671229) has the molecular formula C20H13FN2OS and a molecular weight of 348.40 g/mol. Its IUPAC name is (5Z)-3-(2-fluorophenyl)-5-(naphthalen-2-ylmethylidene)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-(2-fluorophenyl)-5-(naphthalen-2-ylmethylidene)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 98671229 |
| Molecular Formula | C20H13FN2OS |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (5Z)-3-(2-fluorophenyl)-5-(naphthalen-2-ylmethylidene)-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc3ccccc3c2)NC(=S)N1c1ccccc1F |
| InChI | InChI=1S/C20H13FN2OS/c21-16-7-3-4-8-18(16)23-19(24)17(22-20(23)25)12-13-9-10-14-5-1-2-6-15(14)11-13/h1-12H,(H,22,25)/b17-12- |
| InChIKey | SBGOTNNDMSRUQX-ATVHPVEESA-N |
| XLogP | 4.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|