C21H16FN3O2S2 — CID 98652781
(5E)-3-(2-fluorophenyl)-5-[[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 98652781) has the molecular formula C21H16FN3O2S2 and a molecular weight of 425.51 g/mol. Its IUPAC name is (5E)-3-(2-fluorophenyl)-5-[[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-(2-fluorophenyl)-5-[[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 98652781 |
| Molecular Formula | C21H16FN3O2S2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | (5E)-3-(2-fluorophenyl)-5-[[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1nc(COc2ccc(/C=C3/NC(=S)N(c4ccccc4F)C3=O)cc2)cs1 |
| InChI | InChI=1S/C21H16FN3O2S2/c1-13-23-15(12-29-13)11-27-16-8-6-14(7-9-16)10-18-20(26)25(21(28)24-18)19-5-3-2-4-17(19)22/h2-10,12H,11H2,1H3,(H,24,28)/b18-10+ |
| InChIKey | ZABGAEMXFCXOHK-VCHYOVAHSA-N |
| XLogP | 4.43 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|