C20H15FN4OS — CID 37466953
(5E)-5-[(1-benzylpyrazol-4-yl)methylidene]-3-(2-fluorophenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 37466953) has the molecular formula C20H15FN4OS and a molecular weight of 378.43 g/mol. Its IUPAC name is (5E)-5-[(1-benzylpyrazol-4-yl)methylidene]-3-(2-fluorophenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(1-benzylpyrazol-4-yl)methylidene]-3-(2-fluorophenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 37466953 |
| Molecular Formula | C20H15FN4OS |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (5E)-5-[(1-benzylpyrazol-4-yl)methylidene]-3-(2-fluorophenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C\c2cnn(Cc3ccccc3)c2)NC(=S)N1c1ccccc1F |
| InChI | InChI=1S/C20H15FN4OS/c21-16-8-4-5-9-18(16)25-19(26)17(23-20(25)27)10-15-11-22-24(13-15)12-14-6-2-1-3-7-14/h1-11,13H,12H2,(H,23,27)/b17-10+ |
| InChIKey | UFLRYDDJKQHOSY-LICLKQGHSA-N |
| XLogP | 3.33 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|