C23H18F2N4O2S2 — CID 135926640
N-(2,4-difluorophenyl)-N-[4-[(Z)-[2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 135926640) has the molecular formula C23H18F2N4O2S2 and a molecular weight of 484.55 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N-[4-[(Z)-[2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-N-[4-[(Z)-[2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 135926640 |
| Molecular Formula | C23H18F2N4O2S2 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | N-(2,4-difluorophenyl)-N-[4-[(Z)-[2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)N(c1nc(/C=C2\S/C(=N/c3cc(C)ccc3C)NC2=O)cs1)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H18F2N4O2S2/c1-12-4-5-13(2)18(8-12)27-22-28-21(31)20(33-22)10-16-11-32-23(26-16)29(14(3)30)19-7-6-15(24)9-17(19)25/h4-11H,1-3H3,(H,27,28,31)/b20-10- |
| InChIKey | ITTJNKVIQSUAQN-JMIUGGIZSA-N |
| XLogP | 5.61 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|