C14H12N4OS2 — CID 136847264
(5E)-2-(2,5-dimethylphenyl)imino-5-(thiadiazol-4-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 136847264) has the molecular formula C14H12N4OS2 and a molecular weight of 316.41 g/mol. Its IUPAC name is (5E)-2-(2,5-dimethylphenyl)imino-5-(thiadiazol-4-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2,5-dimethylphenyl)imino-5-(thiadiazol-4-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136847264 |
| Molecular Formula | C14H12N4OS2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (5E)-2-(2,5-dimethylphenyl)imino-5-(thiadiazol-4-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(C)c(/N=C2\NC(=O)/C(=C\c3csnn3)S2)c1 |
| InChI | InChI=1S/C14H12N4OS2/c1-8-3-4-9(2)11(5-8)15-14-16-13(19)12(21-14)6-10-7-20-18-17-10/h3-7H,1-2H3,(H,15,16,19)/b12-6+ |
| InChIKey | RIZKVJGRGZZXDT-WUXMJOGZSA-N |
| XLogP | 3.05 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|