C22H15F2N3O3S — CID 24508764
N-[4-[(E)-2-cyano-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-(2,4-difluorophenyl)acetamide (PubChem CID 24508764) has the molecular formula C22H15F2N3O3S and a molecular weight of 439.44 g/mol. Its IUPAC name is N-[4-[(E)-2-cyano-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | N-[4-[(E)-2-cyano-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 24508764 |
| Molecular Formula | C22H15F2N3O3S |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | N-[4-[(E)-2-cyano-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-(2,4-difluorophenyl)acetamide |
| SMILES | COc1ccc(C(=O)/C(C#N)=C/c2csc(N(C(C)=O)c3ccc(F)cc3F)n2)cc1 |
| InChI | InChI=1S/C22H15F2N3O3S/c1-13(28)27(20-8-5-16(23)10-19(20)24)22-26-17(12-31-22)9-15(11-25)21(29)14-3-6-18(30-2)7-4-14/h3-10,12H,1-2H3/b15-9+ |
| InChIKey | OCDZGGRHTGXVOZ-OQLLNIDSSA-N |
| XLogP | 4.90 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|