C25H18F2N2O3S — CID 24508691
N-(2,4-difluorophenyl)-N-[4-[(E)-3-(6-methoxynaphthalen-2-yl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 24508691) has the molecular formula C25H18F2N2O3S and a molecular weight of 464.49 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N-[4-[(E)-3-(6-methoxynaphthalen-2-yl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-N-[4-[(E)-3-(6-methoxynaphthalen-2-yl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 24508691 |
| Molecular Formula | C25H18F2N2O3S |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-N-[4-[(E)-3-(6-methoxynaphthalen-2-yl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccc2cc(C(=O)/C=C/c3csc(N(C(C)=O)c4ccc(F)cc4F)n3)ccc2c1 |
| InChI | InChI=1S/C25H18F2N2O3S/c1-15(30)29(23-9-6-19(26)13-22(23)27)25-28-20(14-33-25)7-10-24(31)18-4-3-17-12-21(32-2)8-5-16(17)11-18/h3-14H,1-2H3/b10-7+ |
| InChIKey | PTOSYTGELBWQDT-JXMROGBWSA-N |
| XLogP | 6.16 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|