C24H24FN3O2S — CID 55592877
(E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(2,5-dimethylphenyl)-N-ethylprop-2-enamide (PubChem CID 55592877) has the molecular formula C24H24FN3O2S and a molecular weight of 437.54 g/mol. Its IUPAC name is (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(2,5-dimethylphenyl)-N-ethylprop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(2,5-dimethylphenyl)-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 55592877 |
| Molecular Formula | C24H24FN3O2S |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(2,5-dimethylphenyl)-N-ethylprop-2-enamide |
| SMILES | CCN(C(=O)/C=C/c1csc(N(C(C)=O)c2ccccc2F)n1)c1cc(C)ccc1C |
| InChI | InChI=1S/C24H24FN3O2S/c1-5-27(22-14-16(2)10-11-17(22)3)23(30)13-12-19-15-31-24(26-19)28(18(4)29)21-9-7-6-8-20(21)25/h6-15H,5H2,1-4H3/b13-12+ |
| InChIKey | CQGRWDKISRQFQV-OUKQBFOZSA-N |
| XLogP | 5.65 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|