C15H11NO2 — CID 12746962
4-methyl-2-phenylisoindole-1,3-dione (PubChem CID 12746962) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-methyl-2-phenylisoindole-1,3-dione.
| Compound Name | 4-methyl-2-phenylisoindole-1,3-dione |
|---|---|
| PubChem CID | 12746962 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 4-methyl-2-phenylisoindole-1,3-dione |
| SMILES | Cc1cccc2c1C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C15H11NO2/c1-10-6-5-9-12-13(10)15(18)16(14(12)17)11-7-3-2-4-8-11/h2-9H,1H3 |
| InChIKey | WNZXCMBIZPSTKV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|