C21H17N3O5 — CID 168558302
4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-(2-methylphenyl)isoindole-1,3-dione (PubChem CID 168558302) has the molecular formula C21H17N3O5 and a molecular weight of 391.38 g/mol. Its IUPAC name is 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-(2-methylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-(2-methylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168558302 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-(2-methylphenyl)isoindole-1,3-dione |
| SMILES | Cc1ccccc1N1C(=O)c2cccc(NC3=CC(=O)N(CCO)C3=O)c2C1=O |
| InChI | InChI=1S/C21H17N3O5/c1-12-5-2-3-8-16(12)24-19(27)13-6-4-7-14(18(13)21(24)29)22-15-11-17(26)23(9-10-25)20(15)28/h2-8,11,22,25H,9-10H2,1H3 |
| InChIKey | CGUUUUSCAFCYLF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|