C25H19N3O4 — CID 168556936
1-(2-hydroxyethyl)-3-[(9-oxo-5-phenyl-10H-acridin-4-yl)amino]pyrrole-2,5-dione (PubChem CID 168556936) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[(9-oxo-5-phenyl-10H-acridin-4-yl)amino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[(9-oxo-5-phenyl-10H-acridin-4-yl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556936 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[(9-oxo-5-phenyl-10H-acridin-4-yl)amino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cccc3c(=O)c4cccc(-c5ccccc5)c4[nH]c23)C(=O)N1CCO |
| InChI | InChI=1S/C25H19N3O4/c29-13-12-28-21(30)14-20(25(28)32)26-19-11-5-10-18-23(19)27-22-16(15-6-2-1-3-7-15)8-4-9-17(22)24(18)31/h1-11,14,26,29H,12-13H2,(H,27,31) |
| InChIKey | REUDLQXLLUQJGU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|