C15H13N3O5 — CID 168559358
4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylisoindole-1,3-dione (PubChem CID 168559358) has the molecular formula C15H13N3O5 and a molecular weight of 315.29 g/mol. Its IUPAC name is 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylisoindole-1,3-dione.
| Compound Name | 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 168559358 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylisoindole-1,3-dione |
| SMILES | CN1C(=O)c2cccc(NC3=CC(=O)N(CCO)C3=O)c2C1=O |
| InChI | InChI=1S/C15H13N3O5/c1-17-13(21)8-3-2-4-9(12(8)15(17)23)16-10-7-11(20)18(5-6-19)14(10)22/h2-4,7,16,19H,5-6H2,1H3 |
| InChIKey | VDRFZTXGIKQLRD-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|