C13H13N5O3 — CID 168556105
1-(2-hydroxyethyl)-3-[(2-methylbenzotriazol-4-yl)amino]pyrrole-2,5-dione (PubChem CID 168556105) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[(2-methylbenzotriazol-4-yl)amino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[(2-methylbenzotriazol-4-yl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556105 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[(2-methylbenzotriazol-4-yl)amino]pyrrole-2,5-dione |
| SMILES | Cn1nc2cccc(NC3=CC(=O)N(CCO)C3=O)c2n1 |
| InChI | InChI=1S/C13H13N5O3/c1-17-15-9-4-2-3-8(12(9)16-17)14-10-7-11(20)18(5-6-19)13(10)21/h2-4,7,14,19H,5-6H2,1H3 |
| InChIKey | WGCHPDQJOPQYQH-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|