C16H18N2O5 — CID 168559856
ethyl 3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylbenzoate (PubChem CID 168559856) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is ethyl 3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylbenzoate.
| Compound Name | ethyl 3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylbenzoate |
|---|---|
| PubChem CID | 168559856 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | ethyl 3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylbenzoate |
| SMILES | CCOC(=O)c1cccc(NC2=CC(=O)N(CCO)C2=O)c1C |
| InChI | InChI=1S/C16H18N2O5/c1-3-23-16(22)11-5-4-6-12(10(11)2)17-13-9-14(20)18(7-8-19)15(13)21/h4-6,9,17,19H,3,7-8H2,1-2H3 |
| InChIKey | YXDXNAZBQRPBRA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|