C19H20N4O5 — CID 168557913
ethyl 2-[2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-5-methyl-1H-imidazole-4-carboxylate (PubChem CID 168557913) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is ethyl 2-[2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-5-methyl-1H-imidazole-4-carboxylate.
| Compound Name | ethyl 2-[2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-5-methyl-1H-imidazole-4-carboxylate |
|---|---|
| PubChem CID | 168557913 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | ethyl 2-[2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-5-methyl-1H-imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccccc2NC2=CC(=O)N(CCO)C2=O)[nH]c1C |
| InChI | InChI=1S/C19H20N4O5/c1-3-28-19(27)16-11(2)20-17(22-16)12-6-4-5-7-13(12)21-14-10-15(25)23(8-9-24)18(14)26/h4-7,10,21,24H,3,8-9H2,1-2H3,(H,20,22) |
| InChIKey | BNMQETMCAGFVIM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|