C20H21N3O4S — CID 169372608
ethyl 5-methyl-2-[2-[(4-methylphenyl)sulfonylamino]phenyl]-1H-imidazole-4-carboxylate (PubChem CID 169372608) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is ethyl 5-methyl-2-[2-[(4-methylphenyl)sulfonylamino]phenyl]-1H-imidazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-2-[2-[(4-methylphenyl)sulfonylamino]phenyl]-1H-imidazole-4-carboxylate |
|---|---|
| PubChem CID | 169372608 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | ethyl 5-methyl-2-[2-[(4-methylphenyl)sulfonylamino]phenyl]-1H-imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccccc2NS(=O)(=O)c2ccc(C)cc2)[nH]c1C |
| InChI | InChI=1S/C20H21N3O4S/c1-4-27-20(24)18-14(3)21-19(22-18)16-7-5-6-8-17(16)23-28(25,26)15-11-9-13(2)10-12-15/h5-12,23H,4H2,1-3H3,(H,21,22) |
| InChIKey | NBMVVSVMRCGFRQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |