C21H18N4O4 — CID 168559726
1-(2-hydroxyethyl)-3-[2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]anilino]pyrrole-2,5-dione (PubChem CID 168559726) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559726 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]anilino]pyrrole-2,5-dione |
| SMILES | Cc1cccc(-c2noc(-c3ccccc3NC3=CC(=O)N(CCO)C3=O)n2)c1 |
| InChI | InChI=1S/C21H18N4O4/c1-13-5-4-6-14(11-13)19-23-20(29-24-19)15-7-2-3-8-16(15)22-17-12-18(27)25(9-10-26)21(17)28/h2-8,11-12,22,26H,9-10H2,1H3 |
| InChIKey | HIMOTHMUALXAHI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|