C14H15N3O4 — CID 168560554
4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3-methylbenzamide (PubChem CID 168560554) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3-methylbenzamide.
| Compound Name | 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3-methylbenzamide |
|---|---|
| PubChem CID | 168560554 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)ccc1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C14H15N3O4/c1-8-6-9(13(15)20)2-3-10(8)16-11-7-12(19)17(4-5-18)14(11)21/h2-3,6-7,16,18H,4-5H2,1H3,(H2,15,20) |
| InChIKey | DSZZDNUEHJQULO-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|