C17H20N2O6 — CID 168557898
tert-butyl 3-hydroxy-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate (PubChem CID 168557898) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate.
| Compound Name | tert-butyl 3-hydroxy-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 168557898 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | tert-butyl 3-hydroxy-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC2=CC(=O)N(CCO)C2=O)c(O)c1 |
| InChI | InChI=1S/C17H20N2O6/c1-17(2,3)25-16(24)10-4-5-11(13(21)8-10)18-12-9-14(22)19(6-7-20)15(12)23/h4-5,8-9,18,20-21H,6-7H2,1-3H3 |
| InChIKey | AHGLGKHPNXPIIJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|