C14H13F3N2O5 — CID 168560293
1-(2-hydroxyethyl)-3-[2-methoxy-4-(trifluoromethoxy)anilino]pyrrole-2,5-dione (PubChem CID 168560293) has the molecular formula C14H13F3N2O5 and a molecular weight of 346.26 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[2-methoxy-4-(trifluoromethoxy)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[2-methoxy-4-(trifluoromethoxy)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168560293 |
| Molecular Formula | C14H13F3N2O5 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[2-methoxy-4-(trifluoromethoxy)anilino]pyrrole-2,5-dione |
| SMILES | COc1cc(OC(F)(F)F)ccc1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C14H13F3N2O5/c1-23-11-6-8(24-14(15,16)17)2-3-9(11)18-10-7-12(21)19(4-5-20)13(10)22/h2-3,6-7,18,20H,4-5H2,1H3 |
| InChIKey | XOUNVAOZAYRSDV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|