C13H9BrF3N3O6 — CID 168556489
3-[2-bromo-6-nitro-4-(trifluoromethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168556489) has the molecular formula C13H9BrF3N3O6 and a molecular weight of 440.13 g/mol. Its IUPAC name is 3-[2-bromo-6-nitro-4-(trifluoromethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[2-bromo-6-nitro-4-(trifluoromethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556489 |
| Molecular Formula | C13H9BrF3N3O6 |
| Molecular Weight | 440.13 g/mol |
| Exact Mass | 438.96 |
| IUPAC Name | 3-[2-bromo-6-nitro-4-(trifluoromethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2c(Br)cc(OC(F)(F)F)cc2[N+](=O)[O-])C(=O)N1CCO |
| InChI | InChI=1S/C13H9BrF3N3O6/c14-7-3-6(26-13(15,16)17)4-9(20(24)25)11(7)18-8-5-10(22)19(1-2-21)12(8)23/h3-5,18,21H,1-2H2 |
| InChIKey | UOCCDAMKWJUGAT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.13 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|