C12H8BrClF2N2O3 — CID 168556241
3-(6-bromo-2-chloro-3,4-difluoroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168556241) has the molecular formula C12H8BrClF2N2O3 and a molecular weight of 381.56 g/mol. Its IUPAC name is 3-(6-bromo-2-chloro-3,4-difluoroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(6-bromo-2-chloro-3,4-difluoroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556241 |
| Molecular Formula | C12H8BrClF2N2O3 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 379.94 |
| IUPAC Name | 3-(6-bromo-2-chloro-3,4-difluoroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2c(Br)cc(F)c(F)c2Cl)C(=O)N1CCO |
| InChI | InChI=1S/C12H8BrClF2N2O3/c13-5-3-6(15)10(16)9(14)11(5)17-7-4-8(20)18(1-2-19)12(7)21/h3-4,17,19H,1-2H2 |
| InChIKey | CGEQUWBSGJAWCT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|