C13H8BrF2N3O3 — CID 168559933
3-bromo-2,5-difluoro-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzonitrile (PubChem CID 168559933) has the molecular formula C13H8BrF2N3O3 and a molecular weight of 372.13 g/mol. Its IUPAC name is 3-bromo-2,5-difluoro-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzonitrile.
| Compound Name | 3-bromo-2,5-difluoro-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 168559933 |
| Molecular Formula | C13H8BrF2N3O3 |
| Molecular Weight | 372.13 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | 3-bromo-2,5-difluoro-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzonitrile |
| SMILES | N#Cc1cc(F)c(NC2=CC(=O)N(CCO)C2=O)c(Br)c1F |
| InChI | InChI=1S/C13H8BrF2N3O3/c14-10-11(16)6(5-17)3-7(15)12(10)18-8-4-9(21)19(1-2-20)13(8)22/h3-4,18,20H,1-2H2 |
| InChIKey | VIDKAQZBIHBSBM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.13 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|