C13H12BrFN2O3 — CID 168557719
3-(5-bromo-2-fluoro-3-methylanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168557719) has the molecular formula C13H12BrFN2O3 and a molecular weight of 343.15 g/mol. Its IUPAC name is 3-(5-bromo-2-fluoro-3-methylanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(5-bromo-2-fluoro-3-methylanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557719 |
| Molecular Formula | C13H12BrFN2O3 |
| Molecular Weight | 343.15 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 3-(5-bromo-2-fluoro-3-methylanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | Cc1cc(Br)cc(NC2=CC(=O)N(CCO)C2=O)c1F |
| InChI | InChI=1S/C13H12BrFN2O3/c1-7-4-8(14)5-9(12(7)15)16-10-6-11(19)17(2-3-18)13(10)20/h4-6,16,18H,2-3H2,1H3 |
| InChIKey | FEYRWGGSABLOSW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.15 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|