C14H14BrFN2O5 — CID 168556967
3-(5-bromo-3-fluoro-2,4-dimethoxyanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168556967) has the molecular formula C14H14BrFN2O5 and a molecular weight of 389.18 g/mol. Its IUPAC name is 3-(5-bromo-3-fluoro-2,4-dimethoxyanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(5-bromo-3-fluoro-2,4-dimethoxyanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556967 |
| Molecular Formula | C14H14BrFN2O5 |
| Molecular Weight | 389.18 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 3-(5-bromo-3-fluoro-2,4-dimethoxyanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | COc1c(Br)cc(NC2=CC(=O)N(CCO)C2=O)c(OC)c1F |
| InChI | InChI=1S/C14H14BrFN2O5/c1-22-12-7(15)5-8(13(23-2)11(12)16)17-9-6-10(20)18(3-4-19)14(9)21/h5-6,17,19H,3-4H2,1-2H3 |
| InChIKey | ALZPCSBNCLPEOC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|