C14H13BrN2O5 — CID 168560511
methyl 4-bromo-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate (PubChem CID 168560511) has the molecular formula C14H13BrN2O5 and a molecular weight of 369.17 g/mol. Its IUPAC name is methyl 4-bromo-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate.
| Compound Name | methyl 4-bromo-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 168560511 |
| Molecular Formula | C14H13BrN2O5 |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | methyl 4-bromo-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Br)c(NC2=CC(=O)N(CCO)C2=O)c1 |
| InChI | InChI=1S/C14H13BrN2O5/c1-22-14(21)8-2-3-9(15)10(6-8)16-11-7-12(19)17(4-5-18)13(11)20/h2-3,6-7,16,18H,4-5H2,1H3 |
| InChIKey | QVKIVGOAASXVJS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|