C22H17N3O7 — CID 168556542
methyl 4-[5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-1,3-dioxoisoindol-2-yl]benzoate (PubChem CID 168556542) has the molecular formula C22H17N3O7 and a molecular weight of 435.39 g/mol. Its IUPAC name is methyl 4-[5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-1,3-dioxoisoindol-2-yl]benzoate.
| Compound Name | methyl 4-[5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-1,3-dioxoisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 168556542 |
| Molecular Formula | C22H17N3O7 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | methyl 4-[5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-1,3-dioxoisoindol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)c3ccc(NC4=CC(=O)N(CCO)C4=O)cc3C2=O)cc1 |
| InChI | InChI=1S/C22H17N3O7/c1-32-22(31)12-2-5-14(6-3-12)25-19(28)15-7-4-13(10-16(15)20(25)29)23-17-11-18(27)24(8-9-26)21(17)30/h2-7,10-11,23,26H,8-9H2,1H3 |
| InChIKey | XIMLJHYZTUJYLU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|