C19H24N2O5 — CID 168557524
hexyl 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate (PubChem CID 168557524) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is hexyl 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate.
| Compound Name | hexyl 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 168557524 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | hexyl 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
| SMILES | CCCCCCOC(=O)c1ccc(NC2=CC(=O)N(CCO)C2=O)cc1 |
| InChI | InChI=1S/C19H24N2O5/c1-2-3-4-5-12-26-19(25)14-6-8-15(9-7-14)20-16-13-17(23)21(10-11-22)18(16)24/h6-9,13,20,22H,2-5,10-12H2,1H3 |
| InChIKey | SSDPIMPQMYHQFS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|