C19H17N3O6 — CID 168559044
methyl 2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenoxy]pyridine-4-carboxylate (PubChem CID 168559044) has the molecular formula C19H17N3O6 and a molecular weight of 383.36 g/mol. Its IUPAC name is methyl 2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenoxy]pyridine-4-carboxylate.
| Compound Name | methyl 2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenoxy]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 168559044 |
| Molecular Formula | C19H17N3O6 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | methyl 2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenoxy]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(Oc2ccc(NC3=CC(=O)N(CCO)C3=O)cc2)c1 |
| InChI | InChI=1S/C19H17N3O6/c1-27-19(26)12-6-7-20-16(10-12)28-14-4-2-13(3-5-14)21-15-11-17(24)22(8-9-23)18(15)25/h2-7,10-11,21,23H,8-9H2,1H3 |
| InChIKey | KSILAJAHNJCPOX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|