C19H18N2O5 — CID 168556374
1-(2-hydroxyethyl)-3-[4-(3-methoxyphenoxy)anilino]pyrrole-2,5-dione (PubChem CID 168556374) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[4-(3-methoxyphenoxy)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[4-(3-methoxyphenoxy)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556374 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[4-(3-methoxyphenoxy)anilino]pyrrole-2,5-dione |
| SMILES | COc1cccc(Oc2ccc(NC3=CC(=O)N(CCO)C3=O)cc2)c1 |
| InChI | InChI=1S/C19H18N2O5/c1-25-15-3-2-4-16(11-15)26-14-7-5-13(6-8-14)20-17-12-18(23)21(9-10-22)19(17)24/h2-8,11-12,20,22H,9-10H2,1H3 |
| InChIKey | SCJOCYYCNKHQAV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|