C20H21N3O4 — CID 168556433
1-(2-hydroxyethyl)-3-[2-[(4-methoxyphenyl)methylamino]anilino]pyrrole-2,5-dione (PubChem CID 168556433) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[2-[(4-methoxyphenyl)methylamino]anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[2-[(4-methoxyphenyl)methylamino]anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556433 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[2-[(4-methoxyphenyl)methylamino]anilino]pyrrole-2,5-dione |
| SMILES | COc1ccc(CNc2ccccc2NC2=CC(=O)N(CCO)C2=O)cc1 |
| InChI | InChI=1S/C20H21N3O4/c1-27-15-8-6-14(7-9-15)13-21-16-4-2-3-5-17(16)22-18-12-19(25)23(10-11-24)20(18)26/h2-9,12,21-22,24H,10-11,13H2,1H3 |
| InChIKey | OMKGUHPYQFPKSR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|