C15H18N2O5S — CID 168560234
1-(2-hydroxyethyl)-3-(2-propylsulfonylanilino)pyrrole-2,5-dione (PubChem CID 168560234) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(2-propylsulfonylanilino)pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-(2-propylsulfonylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168560234 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(2-propylsulfonylanilino)pyrrole-2,5-dione |
| SMILES | CCCS(=O)(=O)c1ccccc1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C15H18N2O5S/c1-2-9-23(21,22)13-6-4-3-5-11(13)16-12-10-14(19)17(7-8-18)15(12)20/h3-6,10,16,18H,2,7-9H2,1H3 |
| InChIKey | QRUSZQMDIXROHG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|