C15H18N2O6S — CID 168559938
3-(5-ethylsulfonyl-2-methoxyanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168559938) has the molecular formula C15H18N2O6S and a molecular weight of 354.38 g/mol. Its IUPAC name is 3-(5-ethylsulfonyl-2-methoxyanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(5-ethylsulfonyl-2-methoxyanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559938 |
| Molecular Formula | C15H18N2O6S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 3-(5-ethylsulfonyl-2-methoxyanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | CCS(=O)(=O)c1ccc(OC)c(NC2=CC(=O)N(CCO)C2=O)c1 |
| InChI | InChI=1S/C15H18N2O6S/c1-3-24(21,22)10-4-5-13(23-2)11(8-10)16-12-9-14(19)17(6-7-18)15(12)20/h4-5,8-9,16,18H,3,6-7H2,1-2H3 |
| InChIKey | QJYMRWSNBKQFCJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|