C14H18N4O5S — CID 168559995
4-(dimethylamino)-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzenesulfonamide (PubChem CID 168559995) has the molecular formula C14H18N4O5S and a molecular weight of 354.39 g/mol. Its IUPAC name is 4-(dimethylamino)-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzenesulfonamide.
| Compound Name | 4-(dimethylamino)-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 168559995 |
| Molecular Formula | C14H18N4O5S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 4-(dimethylamino)-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzenesulfonamide |
| SMILES | CN(C)c1ccc(S(N)(=O)=O)cc1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C14H18N4O5S/c1-17(2)12-4-3-9(24(15,22)23)7-10(12)16-11-8-13(20)18(5-6-19)14(11)21/h3-4,7-8,16,19H,5-6H2,1-2H3,(H2,15,22,23) |
| InChIKey | FBDVSFDGMCNDKY-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|