C13H15N3O5S — CID 168556258
2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-methylbenzenesulfonamide (PubChem CID 168556258) has the molecular formula C13H15N3O5S and a molecular weight of 325.35 g/mol. Its IUPAC name is 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-methylbenzenesulfonamide.
| Compound Name | 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 168556258 |
| Molecular Formula | C13H15N3O5S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccccc1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C13H15N3O5S/c1-14-22(20,21)11-5-3-2-4-9(11)15-10-8-12(18)16(6-7-17)13(10)19/h2-5,8,14-15,17H,6-7H2,1H3 |
| InChIKey | LDMHHFRXTVNGCW-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|