C17H22N4O5S — CID 168559379
1-(2-hydroxyethyl)-3-[2-(4-methylpiperazin-1-yl)sulfonylanilino]pyrrole-2,5-dione (PubChem CID 168559379) has the molecular formula C17H22N4O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[2-(4-methylpiperazin-1-yl)sulfonylanilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[2-(4-methylpiperazin-1-yl)sulfonylanilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559379 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[2-(4-methylpiperazin-1-yl)sulfonylanilino]pyrrole-2,5-dione |
| SMILES | CN1CCN(S(=O)(=O)c2ccccc2NC2=CC(=O)N(CCO)C2=O)CC1 |
| InChI | InChI=1S/C17H22N4O5S/c1-19-6-8-20(9-7-19)27(25,26)15-5-3-2-4-13(15)18-14-12-16(23)21(10-11-22)17(14)24/h2-5,12,18,22H,6-11H2,1H3 |
| InChIKey | FGFRUHIAVLBROC-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|