C14H16BN3O6 — CID 168560011
[2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4-(C-methoxycarbonimidoyl)phenyl]boronic acid (PubChem CID 168560011) has the molecular formula C14H16BN3O6 and a molecular weight of 333.11 g/mol. Its IUPAC name is [2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4-(C-methoxycarbonimidoyl)phenyl]boronic acid.
| Compound Name | [2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4-(C-methoxycarbonimidoyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 168560011 |
| Molecular Formula | C14H16BN3O6 |
| Molecular Weight | 333.11 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4-(C-methoxycarbonimidoyl)phenyl]boronic acid |
| SMILES | [H]/N=C(\OC)c1ccc(B(O)O)c(NC2=CC(=O)N(CCO)C2=O)c1 |
| InChI | InChI=1S/C14H16BN3O6/c1-24-13(16)8-2-3-9(15(22)23)10(6-8)17-11-7-12(20)18(4-5-19)14(11)21/h2-3,6-7,16-17,19,22-23H,4-5H2,1H3/b16-13- |
| InChIKey | YFNBGFZFMUBZGX-SSZFMOIBSA-N |
| XLogP | -2.00 |
| TPSA | 143.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.11 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|