C13H12BN3O5 — CID 168557873
[4-cyano-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]boronic acid (PubChem CID 168557873) has the molecular formula C13H12BN3O5 and a molecular weight of 301.07 g/mol. Its IUPAC name is [4-cyano-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]boronic acid.
| Compound Name | [4-cyano-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]boronic acid |
|---|---|
| PubChem CID | 168557873 |
| Molecular Formula | C13H12BN3O5 |
| Molecular Weight | 301.07 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | [4-cyano-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]boronic acid |
| SMILES | N#Cc1ccc(B(O)O)c(NC2=CC(=O)N(CCO)C2=O)c1 |
| InChI | InChI=1S/C13H12BN3O5/c15-7-8-1-2-9(14(21)22)10(5-8)16-11-6-12(19)17(3-4-18)13(11)20/h1-2,5-6,16,18,21-22H,3-4H2 |
| InChIKey | STQQYTXVPPHRKW-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.07 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|