C20H14F3N3O3S — CID 168556916
3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4-[3-(trifluoromethyl)phenyl]sulfanylbenzonitrile (PubChem CID 168556916) has the molecular formula C20H14F3N3O3S and a molecular weight of 433.41 g/mol. Its IUPAC name is 3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4-[3-(trifluoromethyl)phenyl]sulfanylbenzonitrile.
| Compound Name | 3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4-[3-(trifluoromethyl)phenyl]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 168556916 |
| Molecular Formula | C20H14F3N3O3S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-4-[3-(trifluoromethyl)phenyl]sulfanylbenzonitrile |
| SMILES | N#Cc1ccc(Sc2cccc(C(F)(F)F)c2)c(NC2=CC(=O)N(CCO)C2=O)c1 |
| InChI | InChI=1S/C20H14F3N3O3S/c21-20(22,23)13-2-1-3-14(9-13)30-17-5-4-12(11-24)8-15(17)25-16-10-18(28)26(6-7-27)19(16)29/h1-5,8-10,25,27H,6-7H2 |
| InChIKey | GMCVYFACPXLIMR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|