C22H21F3N2O6 — CID 168556886
3-[3-(dimethoxymethyl)-4-[3-(trifluoromethyl)phenoxy]anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168556886) has the molecular formula C22H21F3N2O6 and a molecular weight of 466.41 g/mol. Its IUPAC name is 3-[3-(dimethoxymethyl)-4-[3-(trifluoromethyl)phenoxy]anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[3-(dimethoxymethyl)-4-[3-(trifluoromethyl)phenoxy]anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556886 |
| Molecular Formula | C22H21F3N2O6 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 3-[3-(dimethoxymethyl)-4-[3-(trifluoromethyl)phenoxy]anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | COC(OC)c1cc(NC2=CC(=O)N(CCO)C2=O)ccc1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F3N2O6/c1-31-21(32-2)16-11-14(26-17-12-19(29)27(8-9-28)20(17)30)6-7-18(16)33-15-5-3-4-13(10-15)22(23,24)25/h3-7,10-12,21,26,28H,8-9H2,1-2H3 |
| InChIKey | NGSXBXWENZTSNP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|