C14H13ClF2N2O4 — CID 168557623
3-[3-chloro-4-(2,2-difluoroethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168557623) has the molecular formula C14H13ClF2N2O4 and a molecular weight of 346.72 g/mol. Its IUPAC name is 3-[3-chloro-4-(2,2-difluoroethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[3-chloro-4-(2,2-difluoroethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557623 |
| Molecular Formula | C14H13ClF2N2O4 |
| Molecular Weight | 346.72 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 3-[3-chloro-4-(2,2-difluoroethoxy)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(OCC(F)F)c(Cl)c2)C(=O)N1CCO |
| InChI | InChI=1S/C14H13ClF2N2O4/c15-9-5-8(1-2-11(9)23-7-12(16)17)18-10-6-13(21)19(3-4-20)14(10)22/h1-2,5-6,12,18,20H,3-4,7H2 |
| InChIKey | DIOKJSJCLFYSAS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.72 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|